C42H59N7O6 — CID 10055898
(3S,6R,9S,15R,18S,21R)-18-(4-aminobutyl)-6,15-dibenzyl-3-[(2S)-butan-2-yl]-16-methyl-1,4,7,13,16,19-hexazatricyclo[19.4.0.09,13]pentacosane-2,5,8,14,17,20-hexone (PubChem CID 10055898) has the molecular formula C42H59N7O6 and a molecular weight of 757.98 g/mol. Its IUPAC name is (3S,6R,9S,15R,18S,21R)-18-(4-aminobutyl)-6,15-dibenzyl-3-[(2S)-butan-2-yl]-16-methyl-1,4,7,13,16,19-hexazatricyclo[19.4.0.09,13]pentacosane-2,5,8,14,17,20-hexone.
| Compound Name | (3S,6R,9S,15R,18S,21R)-18-(4-aminobutyl)-6,15-dibenzyl-3-[(2S)-butan-2-yl]-16-methyl-1,4,7,13,16,19-hexazatricyclo[19.4.0.09,13]pentacosane-2,5,8,14,17,20-hexone |
|---|---|
| PubChem CID | 10055898 |
| Molecular Formula | C42H59N7O6 |
| Molecular Weight | 757.98 g/mol |
| Exact Mass | 757.45 |
| IUPAC Name | (3S,6R,9S,15R,18S,21R)-18-(4-aminobutyl)-6,15-dibenzyl-3-[(2S)-butan-2-yl]-16-methyl-1,4,7,13,16,19-hexazatricyclo[19.4.0.09,13]pentacosane-2,5,8,14,17,20-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@H](CCCCN)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C42H59N7O6/c1-4-28(2)36-42(55)49-24-14-12-21-33(49)38(51)44-31(20-11-13-23-43)40(53)47(3)35(27-30-18-9-6-10-19-30)41(54)48-25-15-22-34(48)39(52)45-32(37(50)46-36)26-29-16-7-5-8-17-29/h5-10,16-19,28,31-36H,4,11-15,20-27,43H2,1-3H3,(H,44,51)(H,45,52)(H,46,50)/t28-,31-,32+,33+,34-,35+,36-/m0/s1 |
| InChIKey | IXSANGWVTZFLAC-UBLJBVQWSA-N |
| XLogP | 2.31 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.98 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|