C48H34ClNO5S3 — CID 10056323
(Z)-3-[3-(4-chlorophenoxy)-5,6-bis[(4-phenylsulfanylphenyl)methoxy]-1-benzothiophen-2-yl]-2-pyridin-4-ylprop-2-enoic acid (PubChem CID 10056323) has the molecular formula C48H34ClNO5S3 and a molecular weight of 836.46 g/mol. Its IUPAC name is (Z)-3-[3-(4-chlorophenoxy)-5,6-bis[(4-phenylsulfanylphenyl)methoxy]-1-benzothiophen-2-yl]-2-pyridin-4-ylprop-2-enoic acid.
| Compound Name | (Z)-3-[3-(4-chlorophenoxy)-5,6-bis[(4-phenylsulfanylphenyl)methoxy]-1-benzothiophen-2-yl]-2-pyridin-4-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 10056323 |
| Molecular Formula | C48H34ClNO5S3 |
| Molecular Weight | 836.46 g/mol |
| Exact Mass | 835.13 |
| IUPAC Name | (Z)-3-[3-(4-chlorophenoxy)-5,6-bis[(4-phenylsulfanylphenyl)methoxy]-1-benzothiophen-2-yl]-2-pyridin-4-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1sc2cc(OCc3ccc(Sc4ccccc4)cc3)c(OCc3ccc(Sc4ccccc4)cc3)cc2c1Oc1ccc(Cl)cc1)c1ccncc1 |
| InChI | InChI=1S/C48H34ClNO5S3/c49-35-15-17-36(18-16-35)55-47-42-27-43(53-30-32-11-19-39(20-12-32)56-37-7-3-1-4-8-37)44(54-31-33-13-21-40(22-14-33)57-38-9-5-2-6-10-38)29-45(42)58-46(47)28-41(48(51)52)34-23-25-50-26-24-34/h1-29H,30-31H2,(H,51,52)/b41-28- |
| InChIKey | FPZUAGVEKQTOFY-DUJXHPOHSA-N |
| XLogP | 13.83 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.46 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|