C27H30N2O5S — CID 100564907
3,4-dimethoxy-N-[(Z)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 100564907) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(Z)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(Z)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 100564907 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 3,4-dimethoxy-N-[(Z)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCCc1ccc(OCCNC(=O)/C(=C/c2cccs2)NC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-4-6-19-8-11-21(12-9-19)34-15-14-28-27(31)23(18-22-7-5-16-35-22)29-26(30)20-10-13-24(32-2)25(17-20)33-3/h5,7-13,16-18H,4,6,14-15H2,1-3H3,(H,28,31)(H,29,30)/b23-18- |
| InChIKey | XRIXFKTVRKBZCG-NKFKGCMQSA-N |
| XLogP | 4.68 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|