C13H22N4O3S2 — CID 100566496
N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 100566496) has the molecular formula C13H22N4O3S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100566496 |
| Molecular Formula | C13H22N4O3S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(S(=O)(=O)NCC2CCCCC2)s1 |
| InChI | InChI=1S/C13H22N4O3S2/c1-9(2)11(18)15-12-16-17-13(21-12)22(19,20)14-8-10-6-4-3-5-7-10/h9-10,14H,3-8H2,1-2H3,(H,15,16,18) |
| InChIKey | TVTMZDUNVQLSCG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|