C14H10Cl2N2O3 — CID 100567038
1-[4-(2,4-dichloroanilino)-3-nitrophenyl]ethanone (PubChem CID 100567038) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 1-[4-(2,4-dichloroanilino)-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-(2,4-dichloroanilino)-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 100567038 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-[4-(2,4-dichloroanilino)-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10Cl2N2O3/c1-8(19)9-2-4-13(14(6-9)18(20)21)17-12-5-3-10(15)7-11(12)16/h2-7,17H,1H3 |
| InChIKey | IWTUKIDLSAATDW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|