C28H31BrN2O3 — CID 100569652
(2R)-2-[(4-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-cyclohexylpropanamide (PubChem CID 100569652) has the molecular formula C28H31BrN2O3 and a molecular weight of 523.47 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-cyclohexylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 100569652 |
| Molecular Formula | C28H31BrN2O3 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-cyclohexylpropanamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(Br)cc1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C28H31BrN2O3/c1-20(28(33)30-24-10-3-2-4-11-24)31(18-21-14-16-23(29)17-15-21)27(32)19-34-26-13-7-9-22-8-5-6-12-25(22)26/h5-9,12-17,20,24H,2-4,10-11,18-19H2,1H3,(H,30,33)/t20-/m1/s1 |
| InChIKey | PDRUKOJNFXRMRY-HXUWFJFHSA-N |
| XLogP | 5.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |