C30H32BrClF3N3O4S — CID 100574406
(2S)-2-[(4-bromophenyl)methyl-[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylpropanamide (PubChem CID 100574406) has the molecular formula C30H32BrClF3N3O4S and a molecular weight of 703.02 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100574406 |
| Molecular Formula | C30H32BrClF3N3O4S |
| Molecular Weight | 703.02 g/mol |
| Exact Mass | 701.09 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H32BrClF3N3O4S/c1-4-5-16-36-29(40)21(3)37(18-22-8-10-23(31)11-9-22)28(39)19-38(43(41,42)25-13-6-20(2)7-14-25)24-12-15-27(32)26(17-24)30(33,34)35/h6-15,17,21H,4-5,16,18-19H2,1-3H3,(H,36,40)/t21-/m0/s1 |
| InChIKey | QQQGVCIIXAGNBG-NRFANRHFSA-N |
| XLogP | 6.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|