C25H29Cl2IN2O3 — CID 100575078
(2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide (PubChem CID 100575078) has the molecular formula C25H29Cl2IN2O3 and a molecular weight of 603.33 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100575078 |
| Molecular Formula | C25H29Cl2IN2O3 |
| Molecular Weight | 603.33 g/mol |
| Exact Mass | 602.06 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C25H29Cl2IN2O3/c1-2-23(25(32)29-20-6-4-3-5-7-20)30(15-17-8-9-18(26)14-22(17)27)24(31)16-33-21-12-10-19(28)11-13-21/h8-14,20,23H,2-7,15-16H2,1H3,(H,29,32)/t23-/m0/s1 |
| InChIKey | OAGJXBRKFBEMDT-QHCPKHFHSA-N |
| XLogP | 6.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|