C23H28BrCl2N3O4S — CID 100575833
(2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 100575833) has the molecular formula C23H28BrCl2N3O4S and a molecular weight of 593.37 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100575833 |
| Molecular Formula | C23H28BrCl2N3O4S |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dichloro-N-methylsulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccc(Br)cc1)C(=O)CN(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C23H28BrCl2N3O4S/c1-4-5-12-27-23(31)16(2)28(14-17-6-8-18(24)9-7-17)22(30)15-29(34(3,32)33)21-13-19(25)10-11-20(21)26/h6-11,13,16H,4-5,12,14-15H2,1-3H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | GGKRRXONDVAXQN-INIZCTEOSA-N |
| XLogP | 4.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|