About (E)-non-5-en-4-ol
(E)-non-5-en-4-ol (PubChem CID 10057595) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is (E)-non-5-en-4-ol.
Molecular Properties
| Compound Name | (E)-non-5-en-4-ol |
| PubChem CID | 10057595 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (E)-non-5-en-4-ol |
| SMILES | CCC/C=C/C(O)CCC |
| InChI | InChI=1S/C9H18O/c1-3-5-6-8-9(10)7-4-2/h6,8-10H,3-5,7H2,1-2H3/b8-6+ |
| InChIKey | AGJGJUGBPXOLEG-SOFGYWHQSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-non-5-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-non-5-en-4-ol?
The IUPAC name of (E)-non-5-en-4-ol (CID 10057595) is (E)-non-5-en-4-ol.
What is the SMILES notation for (E)-non-5-en-4-ol?
The canonical SMILES for (E)-non-5-en-4-ol is CCC/C=C/C(O)CCC.
What is the InChIKey of (E)-non-5-en-4-ol?
The InChIKey is AGJGJUGBPXOLEG-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H18O/c1-3-5-6-8-9(10)7-4-2/h6,8-10H,3-5,7H2,1-2H3/b8-6+.
What are the key properties of (E)-non-5-en-4-ol?
(E)-non-5-en-4-ol has a molecular weight of 142.24 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-non-5-en-4-ol is sourced from PubChem (CID 10057595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).