About 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole
4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole (PubChem CID 100575977) has the molecular formula C11H16ClN3S
and a molecular weight of 257.79 g/mol. Its IUPAC name is 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole.
Molecular Properties
| Compound Name | 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole |
| PubChem CID | 100575977 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole |
| SMILES | Clc1snnc1CN1C[C@@H]2CCCCC[C@@H]21 |
| InChI | InChI=1S/C11H16ClN3S/c12-11-9(13-14-16-11)7-15-6-8-4-2-1-3-5-10(8)15/h8,10H,1-7H2/t8-,10-/m0/s1 |
| InChIKey | ZFBNQTYBFJWFOR-WPRPVWTQSA-N |
| XLogP | 2.96 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole?
The IUPAC name of 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole (CID 100575977) is 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole.
What is the SMILES notation for 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole?
The canonical SMILES for 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole is Clc1snnc1CN1C[C@@H]2CCCCC[C@@H]21.
What is the InChIKey of 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole?
The InChIKey is ZFBNQTYBFJWFOR-WPRPVWTQSA-N. The full InChI is InChI=1S/C11H16ClN3S/c12-11-9(13-14-16-11)7-15-6-8-4-2-1-3-5-10(8)15/h8,10H,1-7H2/t8-,10-/m0/s1.
What are the key properties of 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole?
4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole has a molecular weight of 257.79 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,7S)-8-azabicyclo[5.2.0]nonan-8-yl]methyl]-5-chlorothiadiazole is sourced from PubChem (CID 100575977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).