C22H17N5OS — CID 1005762
2',6'-diamino-2-oxo-1-(2-phenylethyl)spiro[indole-3,4'-thiopyran]-3',5'-dicarbonitrile (PubChem CID 1005762) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 2',6'-diamino-2-oxo-1-(2-phenylethyl)spiro[indole-3,4'-thiopyran]-3',5'-dicarbonitrile.
| Compound Name | 2',6'-diamino-2-oxo-1-(2-phenylethyl)spiro[indole-3,4'-thiopyran]-3',5'-dicarbonitrile |
|---|---|
| PubChem CID | 1005762 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2',6'-diamino-2-oxo-1-(2-phenylethyl)spiro[indole-3,4'-thiopyran]-3',5'-dicarbonitrile |
| SMILES | N#CC1=C(N)SC(N)=C(C#N)C12C(=O)N(CCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C22H17N5OS/c23-12-16-19(25)29-20(26)17(13-24)22(16)15-8-4-5-9-18(15)27(21(22)28)11-10-14-6-2-1-3-7-14/h1-9H,10-11,25-26H2 |
| InChIKey | XOZSJWTYRBIEGD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_G(1)', 'substructure': 'N/A'} |
|---|