About 4,5-diethyl-1,3-dihydroimidazole-2-thione
4,5-diethyl-1,3-dihydroimidazole-2-thione (PubChem CID 10057755) has the molecular formula C7H12N2S
and a molecular weight of 156.25 g/mol. Its IUPAC name is 4,5-diethyl-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4,5-diethyl-1,3-dihydroimidazole-2-thione |
| PubChem CID | 10057755 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4,5-diethyl-1,3-dihydroimidazole-2-thione |
| SMILES | CCc1[nH]c(=S)[nH]c1CC |
| InChI | InChI=1S/C7H12N2S/c1-3-5-6(4-2)9-7(10)8-5/h3-4H2,1-2H3,(H2,8,9,10) |
| InChIKey | CQPLQHZNUBFUMH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethyl-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4,5-diethyl-1,3-dihydroimidazole-2-thione (CID 10057755) is 4,5-diethyl-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4,5-diethyl-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4,5-diethyl-1,3-dihydroimidazole-2-thione is CCc1[nH]c(=S)[nH]c1CC.
What is the InChIKey of 4,5-diethyl-1,3-dihydroimidazole-2-thione?
The InChIKey is CQPLQHZNUBFUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S/c1-3-5-6(4-2)9-7(10)8-5/h3-4H2,1-2H3,(H2,8,9,10).
What are the key properties of 4,5-diethyl-1,3-dihydroimidazole-2-thione?
4,5-diethyl-1,3-dihydroimidazole-2-thione has a molecular weight of 156.25 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 10057755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).