C10H9NO — CID 10057790
5-methylidene-2-phenyl-4H-1,3-oxazole (PubChem CID 10057790) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-methylidene-2-phenyl-4H-1,3-oxazole.
| Compound Name | 5-methylidene-2-phenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 10057790 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-methylidene-2-phenyl-4H-1,3-oxazole |
| SMILES | C=C1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C10H9NO/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-6H,1,7H2 |
| InChIKey | JCQCMFBLFICHIB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |