About 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene
1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene (PubChem CID 10057889) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene.
Analyze 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene (CID 10057889) is 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene.
What is the SMILES notation for 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The canonical SMILES for 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene is Cc1sc(C)c2c1CCCC2.
What is the InChIKey of 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene?
The InChIKey is CRNQUSBVNWNHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c1-7-9-5-3-4-6-10(9)8(2)11-7/h3-6H2,1-2H3.
What are the key properties of 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene?
1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene has a molecular weight of 166.29 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5,6,7-tetrahydro-2-benzothiophene is sourced from PubChem (CID 10057889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).