About 1-phenylmethoxypyrazole
1-phenylmethoxypyrazole (PubChem CID 10058015) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-phenylmethoxypyrazole.
Molecular Properties
| Compound Name | 1-phenylmethoxypyrazole |
| PubChem CID | 10058015 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1-phenylmethoxypyrazole |
| SMILES | c1ccc(COn2cccn2)cc1 |
| InChI | InChI=1S/C10H10N2O/c1-2-5-10(6-3-1)9-13-12-8-4-7-11-12/h1-8H,9H2 |
| InChIKey | XQEPQBYKPDAGIZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylmethoxypyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxypyrazole?
The IUPAC name of 1-phenylmethoxypyrazole (CID 10058015) is 1-phenylmethoxypyrazole.
What is the SMILES notation for 1-phenylmethoxypyrazole?
The canonical SMILES for 1-phenylmethoxypyrazole is c1ccc(COn2cccn2)cc1.
What is the InChIKey of 1-phenylmethoxypyrazole?
The InChIKey is XQEPQBYKPDAGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-2-5-10(6-3-1)9-13-12-8-4-7-11-12/h1-8H,9H2.
What are the key properties of 1-phenylmethoxypyrazole?
1-phenylmethoxypyrazole has a molecular weight of 174.20 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxypyrazole is sourced from PubChem (CID 10058015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).