C31H36N2O2 — CID 100581156
(2R)-N-cyclohexyl-2-[(3-methylphenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide (PubChem CID 100581156) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(3-methylphenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(3-methylphenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100581156 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(3-methylphenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
| SMILES | Cc1cccc(CN(C(=O)Cc2ccccc2)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C31H36N2O2/c1-24-12-11-17-27(20-24)23-33(30(34)22-26-15-7-3-8-16-26)29(21-25-13-5-2-6-14-25)31(35)32-28-18-9-4-10-19-28/h2-3,5-8,11-17,20,28-29H,4,9-10,18-19,21-23H2,1H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | XPJITEMWNJYHGG-GDLZYMKVSA-N |
| XLogP | 5.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |