C29H34ClN3O4S — CID 100581334
(2R)-2-[benzyl-[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100581334) has the molecular formula C29H34ClN3O4S and a molecular weight of 556.13 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[benzyl-[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100581334 |
| Molecular Formula | C29H34ClN3O4S |
| Molecular Weight | 556.13 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (2R)-2-[benzyl-[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C29H34ClN3O4S/c1-3-4-18-31-29(35)27(19-23-12-7-5-8-13-23)32(21-24-14-9-6-10-15-24)28(34)22-33(38(2,36)37)26-17-11-16-25(30)20-26/h5-17,20,27H,3-4,18-19,21-22H2,1-2H3,(H,31,35)/t27-/m1/s1 |
| InChIKey | GBYUBFRVPGWZLK-HHHXNRCGSA-N |
| XLogP | 4.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.13 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|