C11H13BrO3 — CID 100582069
5-bromo-2,3-diethoxybenzaldehyde (PubChem CID 100582069) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 5-bromo-2,3-diethoxybenzaldehyde.
| Compound Name | 5-bromo-2,3-diethoxybenzaldehyde |
|---|---|
| PubChem CID | 100582069 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 5-bromo-2,3-diethoxybenzaldehyde |
| SMILES | CCOc1cc(Br)cc(C=O)c1OCC |
| InChI | InChI=1S/C11H13BrO3/c1-3-14-10-6-9(12)5-8(7-13)11(10)15-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | PVLILOMFFCEMCO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|