About prop-2-enamide;N-propylprop-2-enamide
prop-2-enamide;N-propylprop-2-enamide (PubChem CID 10058214) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is prop-2-enamide;N-propylprop-2-enamide.
Molecular Properties
| Compound Name | prop-2-enamide;N-propylprop-2-enamide |
| PubChem CID | 10058214 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | prop-2-enamide;N-propylprop-2-enamide |
| SMILES | C=CC(=O)NCCC.C=CC(N)=O |
| InChI | InChI=1S/C6H11NO.C3H5NO/c1-3-5-7-6(8)4-2;1-2-3(4)5/h4H,2-3,5H2,1H3,(H,7,8);2H,1H2,(H2,4,5) |
| InChIKey | QEODWPPPHSFEMU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enamide;N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enamide;N-propylprop-2-enamide?
The IUPAC name of prop-2-enamide;N-propylprop-2-enamide (CID 10058214) is prop-2-enamide;N-propylprop-2-enamide.
What is the SMILES notation for prop-2-enamide;N-propylprop-2-enamide?
The canonical SMILES for prop-2-enamide;N-propylprop-2-enamide is C=CC(=O)NCCC.C=CC(N)=O.
What is the InChIKey of prop-2-enamide;N-propylprop-2-enamide?
The InChIKey is QEODWPPPHSFEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C3H5NO/c1-3-5-7-6(8)4-2;1-2-3(4)5/h4H,2-3,5H2,1H3,(H,7,8);2H,1H2,(H2,4,5).
What are the key properties of prop-2-enamide;N-propylprop-2-enamide?
prop-2-enamide;N-propylprop-2-enamide has a molecular weight of 184.24 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enamide;N-propylprop-2-enamide is sourced from PubChem (CID 10058214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).