C25H30Cl2N2O3 — CID 100582282
(2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide (PubChem CID 100582282) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 100582282 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-2-23(25(31)28-18-10-5-3-6-11-18)29(16-20-21(26)14-9-15-22(20)27)24(30)17-32-19-12-7-4-8-13-19/h4,7-9,12-15,18,23H,2-3,5-6,10-11,16-17H2,1H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | CPWIMBSOKDMPSI-QHCPKHFHSA-N |
| XLogP | 5.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |