About (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol
(2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 10058229) has the molecular formula C7H14F3NO
and a molecular weight of 185.19 g/mol. Its IUPAC name is (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 10058229 |
| Molecular Formula | C7H14F3NO |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCN(CC)C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NO/c1-3-11(4-2)5-6(12)7(8,9)10/h6,12H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | REEIQERJJYGQFJ-LURJTMIESA-N |
| XLogP | 1.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol (CID 10058229) is (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol is CCN(CC)C[C@H](O)C(F)(F)F.
What is the InChIKey of (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is REEIQERJJYGQFJ-LURJTMIESA-N. The full InChI is InChI=1S/C7H14F3NO/c1-3-11(4-2)5-6(12)7(8,9)10/h6,12H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol?
(2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 185.19 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(diethylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 10058229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).