C9H19N3O — CID 10058240
(2R)-2,4-diamino-1-piperidin-1-ylbutan-1-one (PubChem CID 10058240) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (2R)-2,4-diamino-1-piperidin-1-ylbutan-1-one.
| Compound Name | (2R)-2,4-diamino-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 10058240 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (2R)-2,4-diamino-1-piperidin-1-ylbutan-1-one |
| SMILES | NCC[C@@H](N)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H19N3O/c10-5-4-8(11)9(13)12-6-2-1-3-7-12/h8H,1-7,10-11H2/t8-/m1/s1 |
| InChIKey | RKBKYSFKXFKBBM-MRVPVSSYSA-N |
| XLogP | -0.32 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |