About 2-octoxypropan-1-ol
2-octoxypropan-1-ol (PubChem CID 10058298) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-octoxypropan-1-ol.
Molecular Properties
| Compound Name | 2-octoxypropan-1-ol |
| PubChem CID | 10058298 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 2-octoxypropan-1-ol |
| SMILES | CCCCCCCCOC(C)CO |
| InChI | InChI=1S/C11H24O2/c1-3-4-5-6-7-8-9-13-11(2)10-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | FWFAVISHBVXODB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxypropan-1-ol?
The IUPAC name of 2-octoxypropan-1-ol (CID 10058298) is 2-octoxypropan-1-ol.
What is the SMILES notation for 2-octoxypropan-1-ol?
The canonical SMILES for 2-octoxypropan-1-ol is CCCCCCCCOC(C)CO.
What is the InChIKey of 2-octoxypropan-1-ol?
The InChIKey is FWFAVISHBVXODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-3-4-5-6-7-8-9-13-11(2)10-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-octoxypropan-1-ol?
2-octoxypropan-1-ol has a molecular weight of 188.31 g/mol, XLogP of 2.74, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxypropan-1-ol is sourced from PubChem (CID 10058298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).