C25H33N3O7S — CID 100583251
(2S)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide (PubChem CID 100583251) has the molecular formula C25H33N3O7S and a molecular weight of 519.62 g/mol. Its IUPAC name is (2S)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide.
| Compound Name | (2S)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
|---|---|
| PubChem CID | 100583251 |
| Molecular Formula | C25H33N3O7S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (2S)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
| SMILES | CC[C@@H](C(=O)N[C@@H]1CC(CC)(CC)Oc2ccccc21)N(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H33N3O7S/c1-6-20(27(36(5,32)33)21-15-17(28(30)31)13-14-23(21)34-4)24(29)26-19-16-25(7-2,8-3)35-22-12-10-9-11-18(19)22/h9-15,19-20H,6-8,16H2,1-5H3,(H,26,29)/t19-,20+/m1/s1 |
| InChIKey | LZGGNNSTGZTPLF-UXHICEINSA-N |
| XLogP | 4.35 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|