About 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene
1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene (PubChem CID 10058353) has the molecular formula C13H15F
and a molecular weight of 190.26 g/mol. Its IUPAC name is 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene |
| PubChem CID | 10058353 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene |
| SMILES | C=CCC[C@H]1C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15F/c1-2-3-4-11-9-13(11)10-5-7-12(14)8-6-10/h2,5-8,11,13H,1,3-4,9H2/t11-,13+/m0/s1 |
| InChIKey | RTSWTFJZBGTBHV-WCQYABFASA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene?
The IUPAC name of 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene (CID 10058353) is 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene.
What is the SMILES notation for 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene?
The canonical SMILES for 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene is C=CCC[C@H]1C[C@@H]1c1ccc(F)cc1.
What is the InChIKey of 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene?
The InChIKey is RTSWTFJZBGTBHV-WCQYABFASA-N. The full InChI is InChI=1S/C13H15F/c1-2-3-4-11-9-13(11)10-5-7-12(14)8-6-10/h2,5-8,11,13H,1,3-4,9H2/t11-,13+/m0/s1.
What are the key properties of 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene?
1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene has a molecular weight of 190.26 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-but-3-enylcyclopropyl]-4-fluorobenzene is sourced from PubChem (CID 10058353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).