About 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one
5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one (PubChem CID 10058372) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one.
Molecular Properties
| Compound Name | 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one |
| PubChem CID | 10058372 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one |
| SMILES | CN1C(=O)c2[nH]cnc2N2CCN=C12 |
| InChI | InChI=1S/C8H9N5O/c1-12-7(14)5-6(11-4-10-5)13-3-2-9-8(12)13/h4H,2-3H2,1H3,(H,10,11) |
| InChIKey | OREATXHYQOBLHW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one?
The IUPAC name of 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one (CID 10058372) is 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one.
What is the SMILES notation for 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one?
The canonical SMILES for 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one is CN1C(=O)c2[nH]cnc2N2CCN=C12.
What is the InChIKey of 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one?
The InChIKey is OREATXHYQOBLHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-12-7(14)5-6(11-4-10-5)13-3-2-9-8(12)13/h4H,2-3H2,1H3,(H,10,11).
What are the key properties of 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one?
5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one has a molecular weight of 191.19 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7,8-dihydro-3H-imidazo[2,1-b]purin-4-one is sourced from PubChem (CID 10058372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).