About 4-(hexylamino)phenol
4-(hexylamino)phenol (PubChem CID 10058440) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(hexylamino)phenol.
Molecular Properties
| Compound Name | 4-(hexylamino)phenol |
| PubChem CID | 10058440 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-(hexylamino)phenol |
| SMILES | CCCCCCNc1ccc(O)cc1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-10-13-11-6-8-12(14)9-7-11/h6-9,13-14H,2-5,10H2,1H3 |
| InChIKey | WKZUDDNCUOCRND-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(hexylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hexylamino)phenol?
The IUPAC name of 4-(hexylamino)phenol (CID 10058440) is 4-(hexylamino)phenol.
What is the SMILES notation for 4-(hexylamino)phenol?
The canonical SMILES for 4-(hexylamino)phenol is CCCCCCNc1ccc(O)cc1.
What is the InChIKey of 4-(hexylamino)phenol?
The InChIKey is WKZUDDNCUOCRND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-2-3-4-5-10-13-11-6-8-12(14)9-7-11/h6-9,13-14H,2-5,10H2,1H3.
What are the key properties of 4-(hexylamino)phenol?
4-(hexylamino)phenol has a molecular weight of 193.29 g/mol, XLogP of 3.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hexylamino)phenol is sourced from PubChem (CID 10058440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).