C22H22N4O3S2 — CID 100584664
2-methoxy-N-[2-methoxy-5-[(4R,5R)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100584664) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-methoxy-N-[2-methoxy-5-[(4R,5R)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[2-methoxy-5-[(4R,5R)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100584664 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-methoxy-N-[2-methoxy-5-[(4R,5R)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cccs2)ccc1OC |
| InChI | InChI=1S/C22H22N4O3S2/c1-28-13-19(27)24-16-12-14(8-9-17(16)29-2)26-21(18-7-5-11-31-18)20(25-22(26)30)15-6-3-4-10-23-15/h3-12,20-21H,13H2,1-2H3,(H,24,27)(H,25,30)/t20-,21-/m0/s1 |
| InChIKey | CUGYWDHIIKXSAL-SFTDATJTSA-N |
| XLogP | 3.91 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|