About 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane
2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane (PubChem CID 10058472) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane |
| PubChem CID | 10058472 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane |
| SMILES | CC(=C1C=CC=C1)C1(C)OCCS1 |
| InChI | InChI=1S/C11H14OS/c1-9(10-5-3-4-6-10)11(2)12-7-8-13-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | ADNZGGWNIVLLQV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane?
The IUPAC name of 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane (CID 10058472) is 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane.
What is the SMILES notation for 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane?
The canonical SMILES for 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane is CC(=C1C=CC=C1)C1(C)OCCS1.
What is the InChIKey of 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane?
The InChIKey is ADNZGGWNIVLLQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-9(10-5-3-4-6-10)11(2)12-7-8-13-11/h3-6H,7-8H2,1-2H3.
What are the key properties of 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane?
2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane has a molecular weight of 194.30 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopenta-2,4-dien-1-ylideneethyl)-2-methyl-1,3-oxathiolane is sourced from PubChem (CID 10058472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).