(2E,7E)-4,9-dioxodeca-2,7-dienoic acid

C10H12O4 — CID 10058506

IUPAC(2E,7E)-4,9-dioxodeca-2,7-dienoic acid
SMILESCC(=O)/C=C/CCC(=O)/C=C/C(=O)O
InChIInChI=1S/C10H12O4/c1-8(11)4-2-3-5-9(12)6-7-10(13)14/h2,4,6-7H,3,5H2,1H3,(H,13,14)/b4-2+,7-6+
InChIKeyBALZUVMCNFVPTL-QWDXOWAMSA-N
MW196.20 g/mol
LogP1.12
Rot. Bonds6

About (2E,7E)-4,9-dioxodeca-2,7-dienoic acid

(2E,7E)-4,9-dioxodeca-2,7-dienoic acid (PubChem CID 10058506) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2E,7E)-4,9-dioxodeca-2,7-dienoic acid.

Molecular Properties

Compound Name(2E,7E)-4,9-dioxodeca-2,7-dienoic acid
PubChem CID10058506
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name(2E,7E)-4,9-dioxodeca-2,7-dienoic acid
SMILESCC(=O)/C=C/CCC(=O)/C=C/C(=O)O
InChIInChI=1S/C10H12O4/c1-8(11)4-2-3-5-9(12)6-7-10(13)14/h2,4,6-7H,3,5H2,1H3,(H,13,14)/b4-2+,7-6+
InChIKeyBALZUVMCNFVPTL-QWDXOWAMSA-N
XLogP1.12
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E,7E)-4,9-dioxodeca-2,7-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,7E)-4,9-dioxodeca-2,7-dienoic acid?
The IUPAC name of (2E,7E)-4,9-dioxodeca-2,7-dienoic acid (CID 10058506) is (2E,7E)-4,9-dioxodeca-2,7-dienoic acid.
What is the SMILES notation for (2E,7E)-4,9-dioxodeca-2,7-dienoic acid?
The canonical SMILES for (2E,7E)-4,9-dioxodeca-2,7-dienoic acid is CC(=O)/C=C/CCC(=O)/C=C/C(=O)O.
What is the InChIKey of (2E,7E)-4,9-dioxodeca-2,7-dienoic acid?
The InChIKey is BALZUVMCNFVPTL-QWDXOWAMSA-N. The full InChI is InChI=1S/C10H12O4/c1-8(11)4-2-3-5-9(12)6-7-10(13)14/h2,4,6-7H,3,5H2,1H3,(H,13,14)/b4-2+,7-6+.
What are the key properties of (2E,7E)-4,9-dioxodeca-2,7-dienoic acid?
(2E,7E)-4,9-dioxodeca-2,7-dienoic acid has a molecular weight of 196.20 g/mol, XLogP of 1.12, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,7E)-4,9-dioxodeca-2,7-dienoic acid is sourced from PubChem (CID 10058506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).