C21H30N4O — CID 100585329
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 100585329) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 100585329 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NCCCN3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C21H30N4O/c1-17-15-18(2)25(23-17)16-19-7-9-20(10-8-19)21(26)22-11-6-14-24-12-4-3-5-13-24/h7-10,15H,3-6,11-14,16H2,1-2H3,(H,22,26) |
| InChIKey | AKLZYJOBBAAWEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|