C10H12ClNO — CID 10058548
7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol (PubChem CID 10058548) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol.
| Compound Name | 7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol |
|---|---|
| PubChem CID | 10058548 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol |
| SMILES | OC1CNCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H12ClNO/c11-8-2-1-7-3-4-12-6-10(13)9(7)5-8/h1-2,5,10,12-13H,3-4,6H2 |
| InChIKey | KVGYVFPNKGJTTP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |