C14H19N — CID 10058652
(4aS,9aR)-N-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine (PubChem CID 10058652) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (4aS,9aR)-N-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine.
| Compound Name | (4aS,9aR)-N-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
|---|---|
| PubChem CID | 10058652 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (4aS,9aR)-N-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
| SMILES | CN[C@@]12CCCC[C@@H]1Cc1ccccc12 |
| InChI | InChI=1S/C14H19N/c1-15-14-9-5-4-7-12(14)10-11-6-2-3-8-13(11)14/h2-3,6,8,12,15H,4-5,7,9-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | KQLIVVYSTDBTMZ-OCCSQVGLSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |