C25H29N3O2 — CID 100587049
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(4-phenyloxan-4-yl)methyl]benzamide (PubChem CID 100587049) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(4-phenyloxan-4-yl)methyl]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(4-phenyloxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 100587049 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(4-phenyloxan-4-yl)methyl]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NCC3(c4ccccc4)CCOCC3)cc2)n1 |
| InChI | InChI=1S/C25H29N3O2/c1-19-16-20(2)28(27-19)17-21-8-10-22(11-9-21)24(29)26-18-25(12-14-30-15-13-25)23-6-4-3-5-7-23/h3-11,16H,12-15,17-18H2,1-2H3,(H,26,29) |
| InChIKey | QFXRFHHHDJBXKK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |