C12H16N2O — CID 10058742
(6-methyl-3-pyridinyl)-[(2R)-2-methylpyrrolidin-1-yl]methanone (PubChem CID 10058742) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl)-[(2R)-2-methylpyrrolidin-1-yl]methanone.
| Compound Name | (6-methyl-3-pyridinyl)-[(2R)-2-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 10058742 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (6-methyl-3-pyridinyl)-[(2R)-2-methylpyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCC[C@H]2C)cn1 |
| InChI | InChI=1S/C12H16N2O/c1-9-5-6-11(8-13-9)12(15)14-7-3-4-10(14)2/h5-6,8,10H,3-4,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | MZDVSGUVIRWGSD-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |