C37H42BrN3O5S — CID 100588342
(2R)-2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100588342) has the molecular formula C37H42BrN3O5S and a molecular weight of 720.73 g/mol. Its IUPAC name is (2R)-2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100588342 |
| Molecular Formula | C37H42BrN3O5S |
| Molecular Weight | 720.73 g/mol |
| Exact Mass | 719.20 |
| IUPAC Name | (2R)-2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C37H42BrN3O5S/c1-4-6-24-39-37(43)35(25-29-13-8-7-9-14-29)40(26-30-15-11-10-12-28(30)3)36(42)27-41(32-18-20-33(21-19-32)46-5-2)47(44,45)34-22-16-31(38)17-23-34/h7-23,35H,4-6,24-27H2,1-3H3,(H,39,43)/t35-/m1/s1 |
| InChIKey | MNVCZWMISGOIMK-PGUFJCEWSA-N |
| XLogP | 6.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.73 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|