C12H16O3 — CID 10058890
[(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] propanoate (PubChem CID 10058890) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] propanoate.
| Compound Name | [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] propanoate |
|---|---|
| PubChem CID | 10058890 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] propanoate |
| SMILES | C#CC1=C(C)[C@H](OC(=O)CC)C[C@@H](O)C1 |
| InChI | InChI=1S/C12H16O3/c1-4-9-6-10(13)7-11(8(9)3)15-12(14)5-2/h1,10-11,13H,5-7H2,2-3H3/t10-,11+/m0/s1 |
| InChIKey | MVMVGGXEGGJOKE-WDEREUQCSA-N |
| XLogP | 1.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|