About 4-bromo-1,5-diethylpyrrole-2-carbaldehyde
4-bromo-1,5-diethylpyrrole-2-carbaldehyde (PubChem CID 100589073) has the molecular formula C9H12BrNO
and a molecular weight of 230.10 g/mol. Its IUPAC name is 4-bromo-1,5-diethylpyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-bromo-1,5-diethylpyrrole-2-carbaldehyde |
| PubChem CID | 100589073 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-bromo-1,5-diethylpyrrole-2-carbaldehyde |
| SMILES | CCc1c(Br)cc(C=O)n1CC |
| InChI | InChI=1S/C9H12BrNO/c1-3-9-8(10)5-7(6-12)11(9)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | FGQSXLWTMXMWGI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,5-diethylpyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,5-diethylpyrrole-2-carbaldehyde?
The IUPAC name of 4-bromo-1,5-diethylpyrrole-2-carbaldehyde (CID 100589073) is 4-bromo-1,5-diethylpyrrole-2-carbaldehyde.
What is the SMILES notation for 4-bromo-1,5-diethylpyrrole-2-carbaldehyde?
The canonical SMILES for 4-bromo-1,5-diethylpyrrole-2-carbaldehyde is CCc1c(Br)cc(C=O)n1CC.
What is the InChIKey of 4-bromo-1,5-diethylpyrrole-2-carbaldehyde?
The InChIKey is FGQSXLWTMXMWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO/c1-3-9-8(10)5-7(6-12)11(9)4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 4-bromo-1,5-diethylpyrrole-2-carbaldehyde?
4-bromo-1,5-diethylpyrrole-2-carbaldehyde has a molecular weight of 230.10 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,5-diethylpyrrole-2-carbaldehyde is sourced from PubChem (CID 100589073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).