About 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one
3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 10058957) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one |
| PubChem CID | 10058957 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC)C=CC(=O)C=C1C(C)(C)C |
| InChI | InChI=1S/C12H18O3/c1-11(2,3)10-8-9(13)6-7-12(10,14-4)15-5/h6-8H,1-5H3 |
| InChIKey | ZBIWVRAADXVOSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one?
The IUPAC name of 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one (CID 10058957) is 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one.
What is the SMILES notation for 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one?
The canonical SMILES for 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one is COC1(OC)C=CC(=O)C=C1C(C)(C)C.
What is the InChIKey of 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one?
The InChIKey is ZBIWVRAADXVOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-11(2,3)10-8-9(13)6-7-12(10,14-4)15-5/h6-8H,1-5H3.
What are the key properties of 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one?
3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one has a molecular weight of 210.27 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4,4-dimethoxycyclohexa-2,5-dien-1-one is sourced from PubChem (CID 10058957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).