About 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium
3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium (PubChem CID 10058975) has the molecular formula C9H7ClN2O2
and a molecular weight of 210.62 g/mol. Its IUPAC name is 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
| PubChem CID | 10058975 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium |
| SMILES | [O-][n+]1onc(-c2ccccc2)c1CCl |
| InChI | InChI=1S/C9H7ClN2O2/c10-6-8-9(11-14-12(8)13)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | NREYEXWRWAMJMT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium?
The IUPAC name of 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium (CID 10058975) is 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium is [O-][n+]1onc(-c2ccccc2)c1CCl.
What is the InChIKey of 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium?
The InChIKey is NREYEXWRWAMJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c10-6-8-9(11-14-12(8)13)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium?
3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium has a molecular weight of 210.62 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 10058975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).