C32H39BrN2O3 — CID 100589820
(2R)-2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100589820) has the molecular formula C32H39BrN2O3 and a molecular weight of 579.58 g/mol. Its IUPAC name is (2R)-2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100589820 |
| Molecular Formula | C32H39BrN2O3 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (2R)-2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)COc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C32H39BrN2O3/c1-5-6-18-34-32(37)29(19-25-13-8-7-9-14-25)35(21-27-15-11-10-12-24(27)4)31(36)22-38-30-17-16-26(23(2)3)20-28(30)33/h7-17,20,23,29H,5-6,18-19,21-22H2,1-4H3,(H,34,37)/t29-/m1/s1 |
| InChIKey | PORHYTLGPBDEMX-GDLZYMKVSA-N |
| XLogP | 6.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|