About N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide
N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 10058984) has the molecular formula C8H9N3O4
and a molecular weight of 211.18 g/mol. Its IUPAC name is N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| PubChem CID | 10058984 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CC(=O)Nc1c(C=O)[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H9N3O4/c1-4(13)9-6-5(3-12)10-8(15)11(2)7(6)14/h3H,1-2H3,(H,9,13)(H,10,15) |
| InChIKey | KAYTZBZIALPEBD-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The IUPAC name of N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (CID 10058984) is N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
What is the SMILES notation for N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The canonical SMILES for N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide is CC(=O)Nc1c(C=O)[nH]c(=O)n(C)c1=O.
What is the InChIKey of N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The InChIKey is KAYTZBZIALPEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O4/c1-4(13)9-6-5(3-12)10-8(15)11(2)7(6)14/h3H,1-2H3,(H,9,13)(H,10,15).
What are the key properties of N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide has a molecular weight of 211.18 g/mol, XLogP of -1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-formyl-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide is sourced from PubChem (CID 10058984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).