About 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one
3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one (PubChem CID 10059017) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one |
| PubChem CID | 10059017 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one |
| SMILES | O=c1on2cccnc2c1-c1ccccc1 |
| InChI | InChI=1S/C12H8N2O2/c15-12-10(9-5-2-1-3-6-9)11-13-7-4-8-14(11)16-12/h1-8H |
| InChIKey | KHTSXVRFPWVGNE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one?
The IUPAC name of 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one (CID 10059017) is 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one.
What is the SMILES notation for 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one?
The canonical SMILES for 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one is O=c1on2cccnc2c1-c1ccccc1.
What is the InChIKey of 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one?
The InChIKey is KHTSXVRFPWVGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12-10(9-5-2-1-3-6-9)11-13-7-4-8-14(11)16-12/h1-8H.
What are the key properties of 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one?
3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one has a molecular weight of 212.21 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-[1,2]oxazolo[2,3-a]pyrimidin-2-one is sourced from PubChem (CID 10059017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).