About 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one
1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one (PubChem CID 10059064) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one |
| PubChem CID | 10059064 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one |
| SMILES | Cc1nc2c(=O)[nH]c3ccccc3c2n1C |
| InChI | InChI=1S/C12H11N3O/c1-7-13-10-11(15(7)2)8-5-3-4-6-9(8)14-12(10)16/h3-6H,1-2H3,(H,14,16) |
| InChIKey | FHVJWRBVDFUNHO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one?
The IUPAC name of 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one (CID 10059064) is 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one.
What is the SMILES notation for 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one?
The canonical SMILES for 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one is Cc1nc2c(=O)[nH]c3ccccc3c2n1C.
What is the InChIKey of 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one?
The InChIKey is FHVJWRBVDFUNHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-7-13-10-11(15(7)2)8-5-3-4-6-9(8)14-12(10)16/h3-6H,1-2H3,(H,14,16).
What are the key properties of 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one?
1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one has a molecular weight of 213.24 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5H-imidazo[4,5-c]quinolin-4-one is sourced from PubChem (CID 10059064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).