C9H14N2O2S — CID 10059095
(7aR)-6-butyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 10059095) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (7aR)-6-butyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | (7aR)-6-butyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 10059095 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (7aR)-6-butyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | CCCCN1C(=O)[C@@H]2CSCN2C1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-2-3-4-10-8(12)7-5-14-6-11(7)9(10)13/h7H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | IQHKVROIAXGHAR-ZETCQYMHSA-N |
| XLogP | 1.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|