About 2-chloro-4-hydroxy-1,4-benzothiazin-3-one
2-chloro-4-hydroxy-1,4-benzothiazin-3-one (PubChem CID 10059146) has the molecular formula C8H6ClNO2S
and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-chloro-4-hydroxy-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-chloro-4-hydroxy-1,4-benzothiazin-3-one |
| PubChem CID | 10059146 |
| Molecular Formula | C8H6ClNO2S |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 2-chloro-4-hydroxy-1,4-benzothiazin-3-one |
| SMILES | O=C1C(Cl)Sc2ccccc2N1O |
| InChI | InChI=1S/C8H6ClNO2S/c9-7-8(11)10(12)5-3-1-2-4-6(5)13-7/h1-4,7,12H |
| InChIKey | TZVJFZOXWMOCJR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-hydroxy-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-hydroxy-1,4-benzothiazin-3-one?
The IUPAC name of 2-chloro-4-hydroxy-1,4-benzothiazin-3-one (CID 10059146) is 2-chloro-4-hydroxy-1,4-benzothiazin-3-one.
What is the SMILES notation for 2-chloro-4-hydroxy-1,4-benzothiazin-3-one?
The canonical SMILES for 2-chloro-4-hydroxy-1,4-benzothiazin-3-one is O=C1C(Cl)Sc2ccccc2N1O.
What is the InChIKey of 2-chloro-4-hydroxy-1,4-benzothiazin-3-one?
The InChIKey is TZVJFZOXWMOCJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2S/c9-7-8(11)10(12)5-3-1-2-4-6(5)13-7/h1-4,7,12H.
What are the key properties of 2-chloro-4-hydroxy-1,4-benzothiazin-3-one?
2-chloro-4-hydroxy-1,4-benzothiazin-3-one has a molecular weight of 215.66 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-hydroxy-1,4-benzothiazin-3-one is sourced from PubChem (CID 10059146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).