About ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate
ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate (PubChem CID 10059204) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate |
| PubChem CID | 10059204 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate |
| SMILES | CCOC(=O)C(C#N)c1cc(C)ccc1C |
| InChI | InChI=1S/C13H15NO2/c1-4-16-13(15)12(8-14)11-7-9(2)5-6-10(11)3/h5-7,12H,4H2,1-3H3 |
| InChIKey | YCWOLYIAMCREFN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate?
The IUPAC name of ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate (CID 10059204) is ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate.
What is the SMILES notation for ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate?
The canonical SMILES for ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate is CCOC(=O)C(C#N)c1cc(C)ccc1C.
What is the InChIKey of ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate?
The InChIKey is YCWOLYIAMCREFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-4-16-13(15)12(8-14)11-7-9(2)5-6-10(11)3/h5-7,12H,4H2,1-3H3.
What are the key properties of ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate?
ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate has a molecular weight of 217.27 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-2-(2,5-dimethylphenyl)acetate is sourced from PubChem (CID 10059204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).