C36H41N3O4S — CID 100592064
(2S)-2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100592064) has the molecular formula C36H41N3O4S and a molecular weight of 611.81 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100592064 |
| Molecular Formula | C36H41N3O4S |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1cccc(C)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H41N3O4S/c1-4-5-22-37-36(41)34(25-30-16-8-6-9-17-30)38(26-31-18-12-14-28(2)23-31)35(40)27-39(32-19-13-15-29(3)24-32)44(42,43)33-20-10-7-11-21-33/h6-21,23-24,34H,4-5,22,25-27H2,1-3H3,(H,37,41)/t34-/m0/s1 |
| InChIKey | ZZBUKEFPWROYNP-UMSFTDKQSA-N |
| XLogP | 6.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|