C13H18O3 — CID 10059414
4',7'a-dimethylspiro[1,3-dioxolane-2,1'-2,3,6,7-tetrahydroindene]-5'-one (PubChem CID 10059414) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 4',7'a-dimethylspiro[1,3-dioxolane-2,1'-2,3,6,7-tetrahydroindene]-5'-one.
| Compound Name | 4',7'a-dimethylspiro[1,3-dioxolane-2,1'-2,3,6,7-tetrahydroindene]-5'-one |
|---|---|
| PubChem CID | 10059414 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4',7'a-dimethylspiro[1,3-dioxolane-2,1'-2,3,6,7-tetrahydroindene]-5'-one |
| SMILES | CC1=C2CCC3(OCCO3)C2(C)CCC1=O |
| InChI | InChI=1S/C13H18O3/c1-9-10-3-6-13(15-7-8-16-13)12(10,2)5-4-11(9)14/h3-8H2,1-2H3 |
| InChIKey | MQTXDSQGJWDSAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |